C14H11F3INO3S — CID 162599033
4-(1,1-difluoroethoxy)-N-(2-fluoro-4-iodophenyl)benzenesulfonamide (PubChem CID 162599033) has the molecular formula C14H11F3INO3S and a molecular weight of 457.21 g/mol. Its IUPAC name is 4-(1,1-difluoroethoxy)-N-(2-fluoro-4-iodophenyl)benzenesulfonamide.
| Compound Name | 4-(1,1-difluoroethoxy)-N-(2-fluoro-4-iodophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162599033 |
| Molecular Formula | C14H11F3INO3S |
| Molecular Weight | 457.21 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 4-(1,1-difluoroethoxy)-N-(2-fluoro-4-iodophenyl)benzenesulfonamide |
| SMILES | CC(F)(F)Oc1ccc(S(=O)(=O)Nc2ccc(I)cc2F)cc1 |
| InChI | InChI=1S/C14H11F3INO3S/c1-14(16,17)22-10-3-5-11(6-4-10)23(20,21)19-13-7-2-9(18)8-12(13)15/h2-8,19H,1H3 |
| InChIKey | YNNIZLHHHQYPTR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|