C23H30F3IN2O3SSi — CID 59386361
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide (PubChem CID 59386361) has the molecular formula C23H30F3IN2O3SSi and a molecular weight of 626.56 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 59386361 |
| Molecular Formula | C23H30F3IN2O3SSi |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(S(=O)(=O)Nc2ccc(F)c(F)c2Nc2ccc(I)cc2F)CC1 |
| InChI | InChI=1S/C23H30F3IN2O3SSi/c1-22(2,3)34(4,5)32-13-12-23(10-11-23)33(30,31)29-19-9-7-16(24)20(26)21(19)28-18-8-6-15(27)14-17(18)25/h6-9,14,28-29H,10-13H2,1-5H3 |
| InChIKey | VIFCWBIJEZTQOG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|