C24H31F3INO3SSi — CID 58133010
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]cyclopropane-1-sulfonamide (PubChem CID 58133010) has the molecular formula C24H31F3INO3SSi and a molecular weight of 625.57 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]cyclopropane-1-sulfonamide.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 58133010 |
| Molecular Formula | C24H31F3INO3SSi |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]cyclopropane-1-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(S(=O)(=O)Nc2ccc(F)c(F)c2Cc2ccc(I)cc2F)CC1 |
| InChI | InChI=1S/C24H31F3INO3SSi/c1-23(2,3)34(4,5)32-13-12-24(10-11-24)33(30,31)29-21-9-8-19(25)22(27)18(21)14-16-6-7-17(28)15-20(16)26/h6-9,15,29H,10-14H2,1-5H3 |
| InChIKey | IDYSORDFUIVQEP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|