C18H18F3IN2O2S — CID 58133055
N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]piperidine-4-sulfonamide (PubChem CID 58133055) has the molecular formula C18H18F3IN2O2S and a molecular weight of 510.32 g/mol. Its IUPAC name is N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]piperidine-4-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 58133055 |
| Molecular Formula | C18H18F3IN2O2S |
| Molecular Weight | 510.32 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]piperidine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Cc1ccc(I)cc1F)C1CCNCC1 |
| InChI | InChI=1S/C18H18F3IN2O2S/c19-15-3-4-17(24-27(25,26)13-5-7-23-8-6-13)14(18(15)21)9-11-1-2-12(22)10-16(11)20/h1-4,10,13,23-24H,5-9H2 |
| InChIKey | JCENMALWMMKENH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|