C18H20F3IN2O2S — CID 58133017
N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[ethyl(methyl)amino]ethanesulfonamide (PubChem CID 58133017) has the molecular formula C18H20F3IN2O2S and a molecular weight of 512.34 g/mol. Its IUPAC name is N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[ethyl(methyl)amino]ethanesulfonamide.
| Compound Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[ethyl(methyl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 58133017 |
| Molecular Formula | C18H20F3IN2O2S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[ethyl(methyl)amino]ethanesulfonamide |
| SMILES | CCN(C)CCS(=O)(=O)Nc1ccc(F)c(F)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C18H20F3IN2O2S/c1-3-24(2)8-9-27(25,26)23-17-7-6-15(19)18(21)14(17)10-12-4-5-13(22)11-16(12)20/h4-7,11,23H,3,8-10H2,1-2H3 |
| InChIKey | VMMQUGUYBDLVFM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|