C15H11F3INO2 — CID 58133120
1-ethyl-4,5-difluoro-3-[(2-fluoro-4-iodophenyl)methyl]-2-nitrobenzene (PubChem CID 58133120) has the molecular formula C15H11F3INO2 and a molecular weight of 421.16 g/mol. Its IUPAC name is 1-ethyl-4,5-difluoro-3-[(2-fluoro-4-iodophenyl)methyl]-2-nitrobenzene.
| Compound Name | 1-ethyl-4,5-difluoro-3-[(2-fluoro-4-iodophenyl)methyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 58133120 |
| Molecular Formula | C15H11F3INO2 |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 1-ethyl-4,5-difluoro-3-[(2-fluoro-4-iodophenyl)methyl]-2-nitrobenzene |
| SMILES | CCc1cc(F)c(F)c(Cc2ccc(I)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F3INO2/c1-2-8-6-13(17)14(18)11(15(8)20(21)22)5-9-3-4-10(19)7-12(9)16/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | FXNMBHLUJSGSNV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|