C21H20F4INO — CID 58483541
(3-butyl-3-fluoroazetidin-1-yl)-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]methanone (PubChem CID 58483541) has the molecular formula C21H20F4INO and a molecular weight of 505.29 g/mol. Its IUPAC name is (3-butyl-3-fluoroazetidin-1-yl)-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]methanone.
| Compound Name | (3-butyl-3-fluoroazetidin-1-yl)-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 58483541 |
| Molecular Formula | C21H20F4INO |
| Molecular Weight | 505.29 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | (3-butyl-3-fluoroazetidin-1-yl)-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]methanone |
| SMILES | CCCCC1(F)CN(C(=O)c2ccc(F)c(F)c2Cc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C21H20F4INO/c1-2-3-8-21(25)11-27(12-21)20(28)15-6-7-17(22)19(24)16(15)9-13-4-5-14(26)10-18(13)23/h4-7,10H,2-3,8-9,11-12H2,1H3 |
| InChIKey | FIXKUVAOLAAJGQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.29 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|