C23H23F3INO3 — CID 58222158
tert-butyl 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetate (PubChem CID 58222158) has the molecular formula C23H23F3INO3 and a molecular weight of 545.34 g/mol. Its IUPAC name is tert-butyl 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetate |
|---|---|
| PubChem CID | 58222158 |
| Molecular Formula | C23H23F3INO3 |
| Molecular Weight | 545.34 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | tert-butyl 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CN(C(=O)c2ccc(F)c(F)c2Cc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C23H23F3INO3/c1-23(2,3)31-20(29)8-13-11-28(12-13)22(30)16-6-7-18(24)21(26)17(16)9-14-4-5-15(27)10-19(14)25/h4-7,10,13H,8-9,11-12H2,1-3H3 |
| InChIKey | HDPYSDBKGLECGK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|