C22H22F3IN2O4 — CID 58222305
1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]-N-(3,4-dihydroxybutyl)azetidine-3-carboxamide (PubChem CID 58222305) has the molecular formula C22H22F3IN2O4 and a molecular weight of 562.33 g/mol. Its IUPAC name is 1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]-N-(3,4-dihydroxybutyl)azetidine-3-carboxamide.
| Compound Name | 1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]-N-(3,4-dihydroxybutyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 58222305 |
| Molecular Formula | C22H22F3IN2O4 |
| Molecular Weight | 562.33 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | 1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]-N-(3,4-dihydroxybutyl)azetidine-3-carboxamide |
| SMILES | O=C(NCCC(O)CO)C1CN(C(=O)c2ccc(F)c(F)c2Cc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C22H22F3IN2O4/c23-18-4-3-16(17(20(18)25)7-12-1-2-14(26)8-19(12)24)22(32)28-9-13(10-28)21(31)27-6-5-15(30)11-29/h1-4,8,13,15,29-30H,5-7,9-11H2,(H,27,31) |
| InChIKey | HASAVIGWVHGOHX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|