C19H15F3INO2 — CID 58222284
2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetaldehyde (PubChem CID 58222284) has the molecular formula C19H15F3INO2 and a molecular weight of 473.23 g/mol. Its IUPAC name is 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetaldehyde.
| Compound Name | 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 58222284 |
| Molecular Formula | C19H15F3INO2 |
| Molecular Weight | 473.23 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 2-[1-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]benzoyl]azetidin-3-yl]acetaldehyde |
| SMILES | O=CCC1CN(C(=O)c2ccc(F)c(F)c2Cc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C19H15F3INO2/c20-16-4-3-14(19(26)24-9-11(10-24)5-6-25)15(18(16)22)7-12-1-2-13(23)8-17(12)21/h1-4,6,8,11H,5,7,9-10H2 |
| InChIKey | XNEWRCYMQSMIIC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|