C19H15F3INO3S — CID 58133015
N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2,5-dimethylfuran-3-sulfonamide (PubChem CID 58133015) has the molecular formula C19H15F3INO3S and a molecular weight of 521.30 g/mol. Its IUPAC name is N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2,5-dimethylfuran-3-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2,5-dimethylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 58133015 |
| Molecular Formula | C19H15F3INO3S |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 520.98 |
| IUPAC Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2,5-dimethylfuran-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2Cc2ccc(I)cc2F)c(C)o1 |
| InChI | InChI=1S/C19H15F3INO3S/c1-10-7-18(11(2)27-10)28(25,26)24-17-6-5-15(20)19(22)14(17)8-12-3-4-13(23)9-16(12)21/h3-7,9,24H,8H2,1-2H3 |
| InChIKey | KDINHOMCSCBFJW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|