C12H12ClIN2O3S — CID 106006619
5-(aminomethyl)-N-(2-chloro-4-iodophenyl)-2-methylfuran-3-sulfonamide (PubChem CID 106006619) has the molecular formula C12H12ClIN2O3S and a molecular weight of 426.66 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-chloro-4-iodophenyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-chloro-4-iodophenyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106006619 |
| Molecular Formula | C12H12ClIN2O3S |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 425.93 |
| IUPAC Name | 5-(aminomethyl)-N-(2-chloro-4-iodophenyl)-2-methylfuran-3-sulfonamide |
| SMILES | Cc1oc(CN)cc1S(=O)(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H12ClIN2O3S/c1-7-12(5-9(6-15)19-7)20(17,18)16-11-3-2-8(14)4-10(11)13/h2-5,16H,6,15H2,1H3 |
| InChIKey | NQWKFLCYFUPPMN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|