C12H11Br2ClN2O3S — CID 106078945
5-(aminomethyl)-2-bromo-N-(2-bromo-5-chloro-4-methylphenyl)furan-3-sulfonamide (PubChem CID 106078945) has the molecular formula C12H11Br2ClN2O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2-bromo-5-chloro-4-methylphenyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2-bromo-5-chloro-4-methylphenyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106078945 |
| Molecular Formula | C12H11Br2ClN2O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 455.85 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2-bromo-5-chloro-4-methylphenyl)furan-3-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)c2cc(CN)oc2Br)cc1Cl |
| InChI | InChI=1S/C12H11Br2ClN2O3S/c1-6-2-8(13)10(4-9(6)15)17-21(18,19)11-3-7(5-16)20-12(11)14/h2-4,17H,5,16H2,1H3 |
| InChIKey | RMTZVKLMAPHLRG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |