C11H9BrCl2N2O3S — CID 106037280
5-(aminomethyl)-2-bromo-N-(2,5-dichlorophenyl)furan-3-sulfonamide (PubChem CID 106037280) has the molecular formula C11H9BrCl2N2O3S and a molecular weight of 400.08 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2,5-dichlorophenyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2,5-dichlorophenyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106037280 |
| Molecular Formula | C11H9BrCl2N2O3S |
| Molecular Weight | 400.08 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2,5-dichlorophenyl)furan-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c(Br)o1 |
| InChI | InChI=1S/C11H9BrCl2N2O3S/c12-11-10(4-7(5-15)19-11)20(17,18)16-9-3-6(13)1-2-8(9)14/h1-4,16H,5,15H2 |
| InChIKey | PXTFJOZLYFDKLU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.08 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |