C11H8BrF3N2O3S — CID 106057989
5-(aminomethyl)-2-bromo-N-(2,3,4-trifluorophenyl)furan-3-sulfonamide (PubChem CID 106057989) has the molecular formula C11H8BrF3N2O3S and a molecular weight of 385.16 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2,3,4-trifluorophenyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2,3,4-trifluorophenyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106057989 |
| Molecular Formula | C11H8BrF3N2O3S |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2,3,4-trifluorophenyl)furan-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2F)c(Br)o1 |
| InChI | InChI=1S/C11H8BrF3N2O3S/c12-11-8(3-5(4-16)20-11)21(18,19)17-7-2-1-6(13)9(14)10(7)15/h1-3,17H,4,16H2 |
| InChIKey | HLFKWBKDJBYHGE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|