C10H9Br2N3O3S — CID 106062158
5-(aminomethyl)-2-bromo-N-(3-bromo-2-pyridinyl)furan-3-sulfonamide (PubChem CID 106062158) has the molecular formula C10H9Br2N3O3S and a molecular weight of 411.08 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(3-bromo-2-pyridinyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(3-bromo-2-pyridinyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106062158 |
| Molecular Formula | C10H9Br2N3O3S |
| Molecular Weight | 411.08 g/mol |
| Exact Mass | 408.87 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(3-bromo-2-pyridinyl)furan-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2ncccc2Br)c(Br)o1 |
| InChI | InChI=1S/C10H9Br2N3O3S/c11-7-2-1-3-14-10(7)15-19(16,17)8-4-6(5-13)18-9(8)12/h1-4H,5,13H2,(H,14,15) |
| InChIKey | BVWGLYARKFWFOR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |