C12H13BrClN3O3S — CID 106086603
2-bromo-N-(3-chloro-2-pyridinyl)-5-(ethylaminomethyl)furan-3-sulfonamide (PubChem CID 106086603) has the molecular formula C12H13BrClN3O3S and a molecular weight of 394.68 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-2-pyridinyl)-5-(ethylaminomethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-(3-chloro-2-pyridinyl)-5-(ethylaminomethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106086603 |
| Molecular Formula | C12H13BrClN3O3S |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 2-bromo-N-(3-chloro-2-pyridinyl)-5-(ethylaminomethyl)furan-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)Nc2ncccc2Cl)c(Br)o1 |
| InChI | InChI=1S/C12H13BrClN3O3S/c1-2-15-7-8-6-10(11(13)20-8)21(18,19)17-12-9(14)4-3-5-16-12/h3-6,15H,2,7H2,1H3,(H,16,17) |
| InChIKey | NLFNRTLOAPOEDL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |