C12H15BrN4O3S — CID 106084083
2-bromo-5-(propylaminomethyl)-N-pyridazin-3-ylfuran-3-sulfonamide (PubChem CID 106084083) has the molecular formula C12H15BrN4O3S and a molecular weight of 375.25 g/mol. Its IUPAC name is 2-bromo-5-(propylaminomethyl)-N-pyridazin-3-ylfuran-3-sulfonamide.
| Compound Name | 2-bromo-5-(propylaminomethyl)-N-pyridazin-3-ylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106084083 |
| Molecular Formula | C12H15BrN4O3S |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-bromo-5-(propylaminomethyl)-N-pyridazin-3-ylfuran-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2cccnn2)c(Br)o1 |
| InChI | InChI=1S/C12H15BrN4O3S/c1-2-5-14-8-9-7-10(12(13)20-9)21(18,19)17-11-4-3-6-15-16-11/h3-4,6-7,14H,2,5,8H2,1H3,(H,16,17) |
| InChIKey | JPTHXPDFLARTED-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|