C13H16BrN3O3S — CID 106033085
2-bromo-5-(propylaminomethyl)-N-pyridin-3-ylfuran-3-sulfonamide (PubChem CID 106033085) has the molecular formula C13H16BrN3O3S and a molecular weight of 374.26 g/mol. Its IUPAC name is 2-bromo-5-(propylaminomethyl)-N-pyridin-3-ylfuran-3-sulfonamide.
| Compound Name | 2-bromo-5-(propylaminomethyl)-N-pyridin-3-ylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106033085 |
| Molecular Formula | C13H16BrN3O3S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 2-bromo-5-(propylaminomethyl)-N-pyridin-3-ylfuran-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2cccnc2)c(Br)o1 |
| InChI | InChI=1S/C13H16BrN3O3S/c1-2-5-15-9-11-7-12(13(14)20-11)21(18,19)17-10-4-3-6-16-8-10/h3-4,6-8,15,17H,2,5,9H2,1H3 |
| InChIKey | WJIIQRFQFPYVCH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|