C12H21BrN2O3S2 — CID 106066222
2-bromo-N-(3-methylsulfanylpropyl)-5-(propylaminomethyl)furan-3-sulfonamide (PubChem CID 106066222) has the molecular formula C12H21BrN2O3S2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 2-bromo-N-(3-methylsulfanylpropyl)-5-(propylaminomethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-(3-methylsulfanylpropyl)-5-(propylaminomethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106066222 |
| Molecular Formula | C12H21BrN2O3S2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-bromo-N-(3-methylsulfanylpropyl)-5-(propylaminomethyl)furan-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCCCSC)c(Br)o1 |
| InChI | InChI=1S/C12H21BrN2O3S2/c1-3-5-14-9-10-8-11(12(13)18-10)20(16,17)15-6-4-7-19-2/h8,14-15H,3-7,9H2,1-2H3 |
| InChIKey | VVBMYRCYKGUXAJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|