C10H17BrN2O3S2 — CID 114141319
2-bromo-5-(ethylaminomethyl)-N-(2-methylsulfanylethyl)furan-3-sulfonamide (PubChem CID 114141319) has the molecular formula C10H17BrN2O3S2 and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-bromo-5-(ethylaminomethyl)-N-(2-methylsulfanylethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(ethylaminomethyl)-N-(2-methylsulfanylethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 114141319 |
| Molecular Formula | C10H17BrN2O3S2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-bromo-5-(ethylaminomethyl)-N-(2-methylsulfanylethyl)furan-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCCSC)c(Br)o1 |
| InChI | InChI=1S/C10H17BrN2O3S2/c1-3-12-7-8-6-9(10(11)16-8)18(14,15)13-4-5-17-2/h6,12-13H,3-5,7H2,1-2H3 |
| InChIKey | SPHYQQLBXZHZNA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|