C13H24N2O3S2 — CID 106080199
5-(ethylaminomethyl)-2-methyl-N-(4-methylsulfanylbutan-2-yl)furan-3-sulfonamide (PubChem CID 106080199) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-2-methyl-N-(4-methylsulfanylbutan-2-yl)furan-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-2-methyl-N-(4-methylsulfanylbutan-2-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106080199 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-(ethylaminomethyl)-2-methyl-N-(4-methylsulfanylbutan-2-yl)furan-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NC(C)CCSC)c(C)o1 |
| InChI | InChI=1S/C13H24N2O3S2/c1-5-14-9-12-8-13(11(3)18-12)20(16,17)15-10(2)6-7-19-4/h8,10,14-15H,5-7,9H2,1-4H3 |
| InChIKey | BNOKUTPGNCOQPH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |