C11H20N2O3S2 — CID 106083828
5-(aminomethyl)-2-methyl-N-(1-methylsulfanylbutan-2-yl)furan-3-sulfonamide (PubChem CID 106083828) has the molecular formula C11H20N2O3S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-(1-methylsulfanylbutan-2-yl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-(1-methylsulfanylbutan-2-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106083828 |
| Molecular Formula | C11H20N2O3S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-(1-methylsulfanylbutan-2-yl)furan-3-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1cc(CN)oc1C |
| InChI | InChI=1S/C11H20N2O3S2/c1-4-9(7-17-3)13-18(14,15)11-5-10(6-12)16-8(11)2/h5,9,13H,4,6-7,12H2,1-3H3 |
| InChIKey | YDSSJMWQDYXUQI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |