C12H22N2O3S — CID 114174620
5-(aminomethyl)-2-methyl-N-(3-methylpentan-3-yl)furan-3-sulfonamide (PubChem CID 114174620) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-(3-methylpentan-3-yl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-(3-methylpentan-3-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 114174620 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-(3-methylpentan-3-yl)furan-3-sulfonamide |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1cc(CN)oc1C |
| InChI | InChI=1S/C12H22N2O3S/c1-5-12(4,6-2)14-18(15,16)11-7-10(8-13)17-9(11)3/h7,14H,5-6,8,13H2,1-4H3 |
| InChIKey | UFSJEUWBOGLUGF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |