C11H20N2O4S — CID 106079921
5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)-2-methylfuran-3-sulfonamide (PubChem CID 106079921) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106079921 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)-2-methylfuran-3-sulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1cc(CN)oc1C |
| InChI | InChI=1S/C11H20N2O4S/c1-8-10(5-9(6-12)17-8)18(14,15)13-7-11(2,3)16-4/h5,13H,6-7,12H2,1-4H3 |
| InChIKey | YDPSWDKUZPFDEF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |