C10H18N2O3S2 — CID 106079881
5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)thiophene-3-sulfonamide (PubChem CID 106079881) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106079881 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxy-2-methylpropyl)thiophene-3-sulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1csc(CN)c1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-10(2,15-3)7-12-17(13,14)9-4-8(5-11)16-6-9/h4,6,12H,5,7,11H2,1-3H3 |
| InChIKey | BKJWTKYZYMYGRF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |