C7H10F2N2O2S2 — CID 115409051
5-(aminomethyl)-N-(2,2-difluoroethyl)thiophene-3-sulfonamide (PubChem CID 115409051) has the molecular formula C7H10F2N2O2S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,2-difluoroethyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,2-difluoroethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115409051 |
| Molecular Formula | C7H10F2N2O2S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 5-(aminomethyl)-N-(2,2-difluoroethyl)thiophene-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCC(F)F)cs1 |
| InChI | InChI=1S/C7H10F2N2O2S2/c8-7(9)3-11-15(12,13)6-1-5(2-10)14-4-6/h1,4,7,11H,2-3,10H2 |
| InChIKey | ZXPILSJCDYARFI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |