C9H16N2O3S2 — CID 106056951
5-(aminomethyl)-N-(1-methoxypropan-2-yl)thiophene-3-sulfonamide (PubChem CID 106056951) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(1-methoxypropan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(1-methoxypropan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106056951 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(aminomethyl)-N-(1-methoxypropan-2-yl)thiophene-3-sulfonamide |
| SMILES | COCC(C)NS(=O)(=O)c1csc(CN)c1 |
| InChI | InChI=1S/C9H16N2O3S2/c1-7(5-14-2)11-16(12,13)9-3-8(4-10)15-6-9/h3,6-7,11H,4-5,10H2,1-2H3 |
| InChIKey | JDHSYCZEAOSNEL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |