C12H13FN2O3S2 — CID 106030415
5-(aminomethyl)-N-(3-fluoro-4-methoxyphenyl)thiophene-3-sulfonamide (PubChem CID 106030415) has the molecular formula C12H13FN2O3S2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(3-fluoro-4-methoxyphenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(3-fluoro-4-methoxyphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106030415 |
| Molecular Formula | C12H13FN2O3S2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-(aminomethyl)-N-(3-fluoro-4-methoxyphenyl)thiophene-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2csc(CN)c2)cc1F |
| InChI | InChI=1S/C12H13FN2O3S2/c1-18-12-3-2-8(4-11(12)13)15-20(16,17)10-5-9(6-14)19-7-10/h2-5,7,15H,6,14H2,1H3 |
| InChIKey | LSSBLWYCSKWGLL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |