C13H14N2O5S2 — CID 20900799
4-[(3,4-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxamide (PubChem CID 20900799) has the molecular formula C13H14N2O5S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20900799 |
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2csc(C(N)=O)c2)cc1OC |
| InChI | InChI=1S/C13H14N2O5S2/c1-19-10-4-3-8(5-11(10)20-2)15-22(17,18)9-6-12(13(14)16)21-7-9/h3-7,15H,1-2H3,(H2,14,16) |
| InChIKey | VEBZXXYRPNTEIF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |