C13H12N2O4S2 — CID 6503881
4-[(4-acetylphenyl)sulfamoyl]thiophene-2-carboxamide (PubChem CID 6503881) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)sulfamoyl]thiophene-2-carboxamide.
| Compound Name | 4-[(4-acetylphenyl)sulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503881 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-[(4-acetylphenyl)sulfamoyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2csc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C13H12N2O4S2/c1-8(16)9-2-4-10(5-3-9)15-21(18,19)11-6-12(13(14)17)20-7-11/h2-7,15H,1H3,(H2,14,17) |
| InChIKey | TVEXBWOYHOMMKL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |