C12H12N2O4S2 — CID 6486042
4-[(4-methoxyphenyl)sulfamoyl]thiophene-2-carboxamide (PubChem CID 6486042) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfamoyl]thiophene-2-carboxamide.
| Compound Name | 4-[(4-methoxyphenyl)sulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6486042 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfamoyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2csc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-18-9-4-2-8(3-5-9)14-20(16,17)10-6-11(12(13)15)19-7-10/h2-7,14H,1H3,(H2,13,15) |
| InChIKey | CYZZEMXXRIYRKA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |