C14H16N2O5S2 — CID 6503913
4-[(2,4-dimethoxyphenyl)sulfamoyl]-N-methylthiophene-2-carboxamide (PubChem CID 6503913) has the molecular formula C14H16N2O5S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)sulfamoyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 4-[(2,4-dimethoxyphenyl)sulfamoyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503913 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)sulfamoyl]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)Nc2ccc(OC)cc2OC)cs1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-15-14(17)13-7-10(8-22-13)23(18,19)16-11-5-4-9(20-2)6-12(11)21-3/h4-8,16H,1-3H3,(H,15,17) |
| InChIKey | OMYOTSGZWUOEFF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |