C13H16N2O4S2 — CID 106058867
5-(aminomethyl)-N-(2,5-dimethoxyphenyl)thiophene-3-sulfonamide (PubChem CID 106058867) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,5-dimethoxyphenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,5-dimethoxyphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106058867 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-(aminomethyl)-N-(2,5-dimethoxyphenyl)thiophene-3-sulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2csc(CN)c2)c1 |
| InChI | InChI=1S/C13H16N2O4S2/c1-18-9-3-4-13(19-2)12(5-9)15-21(16,17)11-6-10(7-14)20-8-11/h3-6,8,15H,7,14H2,1-2H3 |
| InChIKey | YCPAMHIVILVXEM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |