C13H15ClN2O3S2 — CID 106087259
5-(aminomethyl)-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-3-sulfonamide (PubChem CID 106087259) has the molecular formula C13H15ClN2O3S2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106087259 |
| Molecular Formula | C13H15ClN2O3S2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-(aminomethyl)-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-3-sulfonamide |
| SMILES | COc1cccc(Cl)c1CNS(=O)(=O)c1csc(CN)c1 |
| InChI | InChI=1S/C13H15ClN2O3S2/c1-19-13-4-2-3-12(14)11(13)7-16-21(17,18)10-5-9(6-15)20-8-10/h2-5,8,16H,6-7,15H2,1H3 |
| InChIKey | KORBBRWKEZNDRJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |