C12H10BrCl2NO3S2 — CID 103293302
5-bromo-4-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-2-sulfonamide (PubChem CID 103293302) has the molecular formula C12H10BrCl2NO3S2 and a molecular weight of 431.16 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103293302 |
| Molecular Formula | C12H10BrCl2NO3S2 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 428.87 |
| IUPAC Name | 5-bromo-4-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(Cl)c1CNS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H10BrCl2NO3S2/c1-19-10-4-2-3-8(14)7(10)6-16-21(17,18)11-5-9(15)12(13)20-11/h2-5,16H,6H2,1H3 |
| InChIKey | YWCCEYQXLCJPDH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |