C8H8BrCl2NO4S2 — CID 103493476
methyl 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-chloropropanoate (PubChem CID 103493476) has the molecular formula C8H8BrCl2NO4S2 and a molecular weight of 397.10 g/mol. Its IUPAC name is methyl 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-chloropropanoate.
| Compound Name | methyl 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-chloropropanoate |
|---|---|
| PubChem CID | 103493476 |
| Molecular Formula | C8H8BrCl2NO4S2 |
| Molecular Weight | 397.10 g/mol |
| Exact Mass | 394.85 |
| IUPAC Name | methyl 3-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-2-chloropropanoate |
| SMILES | COC(=O)C(Cl)CNS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C8H8BrCl2NO4S2/c1-16-8(13)5(11)3-12-18(14,15)6-2-4(10)7(9)17-6/h2,5,12H,3H2,1H3 |
| InChIKey | GWSBYRJPGQNXJH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.10 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|