C9H12BrNO5S2 — CID 104936772
3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methoxypropanoic acid (PubChem CID 104936772) has the molecular formula C9H12BrNO5S2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 104936772 |
| Molecular Formula | C9H12BrNO5S2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNS(=O)(=O)c1cc(C)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H12BrNO5S2/c1-5-3-7(17-8(5)10)18(14,15)11-4-6(16-2)9(12)13/h3,6,11H,4H2,1-2H3,(H,12,13) |
| InChIKey | OJNMDBLTSDNZPA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |