C8H10BrNO5S2 — CID 79987643
3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 79987643) has the molecular formula C8H10BrNO5S2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 79987643 |
| Molecular Formula | C8H10BrNO5S2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 3-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCC(O)C(=O)O)sc1Br |
| InChI | InChI=1S/C8H10BrNO5S2/c1-4-2-6(16-7(4)9)17(14,15)10-3-5(11)8(12)13/h2,5,10-11H,3H2,1H3,(H,12,13) |
| InChIKey | HGSXYBRVJSDVHL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |