C7H9BrClNO3S2 — CID 80577968
5-bromo-4-chloro-N-(1-hydroxypropan-2-yl)thiophene-2-sulfonamide (PubChem CID 80577968) has the molecular formula C7H9BrClNO3S2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(1-hydroxypropan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(1-hydroxypropan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577968 |
| Molecular Formula | C7H9BrClNO3S2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 332.89 |
| IUPAC Name | 5-bromo-4-chloro-N-(1-hydroxypropan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(CO)NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C7H9BrClNO3S2/c1-4(3-11)10-15(12,13)6-2-5(9)7(8)14-6/h2,4,10-11H,3H2,1H3 |
| InChIKey | QLSINEASUJNKJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |