C10H15BrClNO2S2 — CID 80580103
5-bromo-4-chloro-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide (PubChem CID 80580103) has the molecular formula C10H15BrClNO2S2 and a molecular weight of 360.73 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80580103 |
| Molecular Formula | C10H15BrClNO2S2 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(Cl)c(Br)s1)C(C)C |
| InChI | InChI=1S/C10H15BrClNO2S2/c1-4-8(6(2)3)13-17(14,15)9-5-7(12)10(11)16-9/h5-6,8,13H,4H2,1-3H3 |
| InChIKey | INDVKFUDGKUTJA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |