C9H15ClN2O2S2 — CID 61472310
2-chloro-N-(2-methylpentan-3-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 61472310) has the molecular formula C9H15ClN2O2S2 and a molecular weight of 282.82 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpentan-3-yl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-methylpentan-3-yl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61472310 |
| Molecular Formula | C9H15ClN2O2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-chloro-N-(2-methylpentan-3-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cnc(Cl)s1)C(C)C |
| InChI | InChI=1S/C9H15ClN2O2S2/c1-4-7(6(2)3)12-16(13,14)8-5-11-9(10)15-8/h5-7,12H,4H2,1-3H3 |
| InChIKey | IXNPLNKDJGJCSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |