C8H13ClN2O3S2 — CID 104760009
2-chloro-N-(2-propan-2-yloxyethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 104760009) has the molecular formula C8H13ClN2O3S2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-chloro-N-(2-propan-2-yloxyethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-propan-2-yloxyethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 104760009 |
| Molecular Formula | C8H13ClN2O3S2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 2-chloro-N-(2-propan-2-yloxyethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | CC(C)OCCNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2O3S2/c1-6(2)14-4-3-11-16(12,13)7-5-10-8(9)15-7/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | RRSBZDFRGDHXAQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|