C6H9ClN2O3S2 — CID 61051529
2-chloro-N-(3-hydroxypropyl)-1,3-thiazole-5-sulfonamide (PubChem CID 61051529) has the molecular formula C6H9ClN2O3S2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxypropyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3-hydroxypropyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61051529 |
| Molecular Formula | C6H9ClN2O3S2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-chloro-N-(3-hydroxypropyl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCO)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H9ClN2O3S2/c7-6-8-4-5(13-6)14(11,12)9-2-1-3-10/h4,9-10H,1-3H2 |
| InChIKey | POZQPWDDCAHDGK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|