C9H14ClN3O4S2 — CID 113409837
3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 113409837) has the molecular formula C9H14ClN3O4S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 113409837 |
| Molecular Formula | C9H14ClN3O4S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H14ClN3O4S2/c1-17-5-4-11-7(14)2-3-13-19(15,16)8-6-12-9(10)18-8/h6,13H,2-5H2,1H3,(H,11,14) |
| InChIKey | CJXXDAUWOZXOIY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|