C11H18N4O4S — CID 103307140
3-[(3-amino-2-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 103307140) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[(3-amino-2-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(3-amino-2-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 103307140 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[(3-amino-2-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNS(=O)(=O)c1ncccc1N |
| InChI | InChI=1S/C11H18N4O4S/c1-19-8-7-13-10(16)4-6-15-20(17,18)11-9(12)3-2-5-14-11/h2-3,5,15H,4,6-8,12H2,1H3,(H,13,16) |
| InChIKey | YIADKAHOLZLOEM-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|