C9H13F2N3O3S — CID 114129366
3-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2-sulfonamide (PubChem CID 114129366) has the molecular formula C9H13F2N3O3S and a molecular weight of 281.28 g/mol. Its IUPAC name is 3-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2-sulfonamide.
| Compound Name | 3-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 114129366 |
| Molecular Formula | C9H13F2N3O3S |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-2-sulfonamide |
| SMILES | Nc1cccnc1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C9H13F2N3O3S/c10-8(11)6-17-5-4-14-18(15,16)9-7(12)2-1-3-13-9/h1-3,8,14H,4-6,12H2 |
| InChIKey | WQWBLYGEIIZKQQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|