About 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide
2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 91812348) has the molecular formula C6H11N3O3S2
and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 91812348 |
| Molecular Formula | C6H11N3O3S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C6H11N3O3S2/c1-12-3-2-9-14(10,11)5-4-8-6(7)13-5/h4,9H,2-3H2,1H3,(H2,7,8) |
| InChIKey | YAXKHFVFXXIGLP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide (CID 91812348) is 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide is COCCNS(=O)(=O)c1cnc(N)s1.
What is the InChIKey of 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide?
The InChIKey is YAXKHFVFXXIGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3S2/c1-12-3-2-9-14(10,11)5-4-8-6(7)13-5/h4,9H,2-3H2,1H3,(H2,7,8).
What are the key properties of 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide?
2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide has a molecular weight of 237.31 g/mol, XLogP of -0.35, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 91812348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).