C7H11N3O2S — CID 82171902
2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide (PubChem CID 82171902) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 82171902 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C7H11N3O2S/c1-12-3-2-9-6(11)5-4-10-7(8)13-5/h4H,2-3H2,1H3,(H2,8,10)(H,9,11) |
| InChIKey | RCKYJTKHGNTPOZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|