C8H13N3O4S2 — CID 86629880
ethyl 3-[(2-amino-1,3-thiazol-5-yl)sulfonylamino]propanoate (PubChem CID 86629880) has the molecular formula C8H13N3O4S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl 3-[(2-amino-1,3-thiazol-5-yl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-[(2-amino-1,3-thiazol-5-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 86629880 |
| Molecular Formula | C8H13N3O4S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | ethyl 3-[(2-amino-1,3-thiazol-5-yl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)CCNS(=O)(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C8H13N3O4S2/c1-2-15-6(12)3-4-11-17(13,14)7-5-10-8(9)16-7/h5,11H,2-4H2,1H3,(H2,9,10) |
| InChIKey | MKEKYOZQJSFNBB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |